C13H11FN2O4 — CID 62023747
1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 62023747) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 62023747 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(=O)Cn2ccc(=O)[nH]c2=O)cc1F |
| InChI | InChI=1S/C13H11FN2O4/c1-20-11-3-2-8(6-9(11)14)10(17)7-16-5-4-12(18)15-13(16)19/h2-6H,7H2,1H3,(H,15,18,19) |
| InChIKey | PFOSPRIWCYLIHT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |