C13H14N2O4 — CID 22456831
3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1H-imidazol-2-one (PubChem CID 22456831) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1H-imidazol-2-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 22456831 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1H-imidazol-2-one |
| SMILES | COc1ccc(C(=O)Cn2cc[nH]c2=O)cc1OC |
| InChI | InChI=1S/C13H14N2O4/c1-18-11-4-3-9(7-12(11)19-2)10(16)8-15-6-5-14-13(15)17/h3-7H,8H2,1-2H3,(H,14,17) |
| InChIKey | ZVDIWCAWAXTWHV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |