C22H31N3O4 — CID 13034669
3-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one (PubChem CID 13034669) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 13034669 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[1-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
| SMILES | COc1ccc(C(=O)CN2CCC(N3C(=O)NC4CCCCC43)CC2)cc1OC |
| InChI | InChI=1S/C22H31N3O4/c1-28-20-8-7-15(13-21(20)29-2)19(26)14-24-11-9-16(10-12-24)25-18-6-4-3-5-17(18)23-22(25)27/h7-8,13,16-18H,3-6,9-12,14H2,1-2H3,(H,23,27) |
| InChIKey | IQSOIBHKZNZWPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |