C14H18BrN2O3+ — CID 126958504
1-(3,4-dimethoxyphenyl)-2-(3-methylimidazol-3-ium-1-yl)ethanone;hydrobromide (PubChem CID 126958504) has the molecular formula C14H18BrN2O3+ and a molecular weight of 342.21 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(3-methylimidazol-3-ium-1-yl)ethanone;hydrobromide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(3-methylimidazol-3-ium-1-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 126958504 |
| Molecular Formula | C14H18BrN2O3+ |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(3-methylimidazol-3-ium-1-yl)ethanone;hydrobromide |
| SMILES | Br.COc1ccc(C(=O)Cn2cc[n+](C)c2)cc1OC |
| InChI | InChI=1S/C14H17N2O3.BrH/c1-15-6-7-16(10-15)9-12(17)11-4-5-13(18-2)14(8-11)19-3;/h4-8,10H,9H2,1-3H3;1H/q+1; |
| InChIKey | BXGWSFCQZOWVMV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|