C18H22NO3+ — CID 14210673
1-(3,4-dimethoxyphenyl)-4-(4-methylpyridin-1-ium-1-yl)butan-1-one (PubChem CID 14210673) has the molecular formula C18H22NO3+ and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-(4-methylpyridin-1-ium-1-yl)butan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-(4-methylpyridin-1-ium-1-yl)butan-1-one |
|---|---|
| PubChem CID | 14210673 |
| Molecular Formula | C18H22NO3+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-(4-methylpyridin-1-ium-1-yl)butan-1-one |
| SMILES | COc1ccc(C(=O)CCC[n+]2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C18H22NO3/c1-14-8-11-19(12-9-14)10-4-5-16(20)15-6-7-17(21-2)18(13-15)22-3/h6-9,11-13H,4-5,10H2,1-3H3/q+1 |
| InChIKey | CISGWHILMWZPEQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|