C14H15FN2O4 — CID 66062364
4-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-methylpiperazine-2,6-dione (PubChem CID 66062364) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 4-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062364 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-methylpiperazine-2,6-dione |
| SMILES | COc1ccc(C(=O)CN2CC(=O)NC(=O)C2C)cc1F |
| InChI | InChI=1S/C14H15FN2O4/c1-8-14(20)16-13(19)7-17(8)6-11(18)9-3-4-12(21-2)10(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,16,19,20) |
| InChIKey | DKGFUTPQTXLFCT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|