C19H21FN2O5 — CID 8607595
1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-[(1R,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione (PubChem CID 8607595) has the molecular formula C19H21FN2O5 and a molecular weight of 376.38 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-[(1R,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-[(1R,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8607595 |
| Molecular Formula | C19H21FN2O5 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-[(1R,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(C(=O)CN2C(=O)C(=O)N([C@@H]3CCCC[C@H]3C)C2=O)cc1F |
| InChI | InChI=1S/C19H21FN2O5/c1-11-5-3-4-6-14(11)22-18(25)17(24)21(19(22)26)10-15(23)12-7-8-16(27-2)13(20)9-12/h7-9,11,14H,3-6,10H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | NFZVMPMSTKIWML-BXUZGUMPSA-N |
| XLogP | 2.39 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|