C20H27ClN3O4+ — CID 9332785
(5-chloro-2-methoxyphenyl)methyl-methyl-[[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium (PubChem CID 9332785) has the molecular formula C20H27ClN3O4+ and a molecular weight of 408.91 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9332785 |
| Molecular Formula | C20H27ClN3O4+ |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH+](C)CN1C(=O)C(=O)N([C@@H]2CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C20H26ClN3O4/c1-13-6-4-5-7-16(13)24-19(26)18(25)23(20(24)27)12-22(2)11-14-10-15(21)8-9-17(14)28-3/h8-10,13,16H,4-7,11-12H2,1-3H3/p+1/t13-,16-/m1/s1 |
| InChIKey | KYJIVLBJSYOZRO-CZUORRHYSA-O |
| XLogP | 1.69 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|