C12H9IN2O3 — CID 62023373
1-[2-(4-iodophenyl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 62023373) has the molecular formula C12H9IN2O3 and a molecular weight of 356.12 g/mol. Its IUPAC name is 1-[2-(4-iodophenyl)-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(4-iodophenyl)-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 62023373 |
| Molecular Formula | C12H9IN2O3 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1-[2-(4-iodophenyl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H9IN2O3/c13-9-3-1-8(2-4-9)10(16)7-15-6-5-11(17)14-12(15)18/h1-6H,7H2,(H,14,17,18) |
| InChIKey | ZIYUYVIZKPGYHE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|