C13H11IN2O3 — CID 55156628
1-[2-(4-iodophenyl)-2-oxoethyl]-4-methylpyrazine-2,3-dione (PubChem CID 55156628) has the molecular formula C13H11IN2O3 and a molecular weight of 370.15 g/mol. Its IUPAC name is 1-[2-(4-iodophenyl)-2-oxoethyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[2-(4-iodophenyl)-2-oxoethyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 55156628 |
| Molecular Formula | C13H11IN2O3 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 1-[2-(4-iodophenyl)-2-oxoethyl]-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(CC(=O)c2ccc(I)cc2)c(=O)c1=O |
| InChI | InChI=1S/C13H11IN2O3/c1-15-6-7-16(13(19)12(15)18)8-11(17)9-2-4-10(14)5-3-9/h2-7H,8H2,1H3 |
| InChIKey | NQMJEQJRBNXKRG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|