C15H17IN2O3 — CID 79936681
1-[2-(4-iodophenyl)-2-oxoethyl]-4-propylpiperazine-2,5-dione (PubChem CID 79936681) has the molecular formula C15H17IN2O3 and a molecular weight of 400.22 g/mol. Its IUPAC name is 1-[2-(4-iodophenyl)-2-oxoethyl]-4-propylpiperazine-2,5-dione.
| Compound Name | 1-[2-(4-iodophenyl)-2-oxoethyl]-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79936681 |
| Molecular Formula | C15H17IN2O3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-[2-(4-iodophenyl)-2-oxoethyl]-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CC(=O)c2ccc(I)cc2)CC1=O |
| InChI | InChI=1S/C15H17IN2O3/c1-2-7-17-9-15(21)18(10-14(17)20)8-13(19)11-3-5-12(16)6-4-11/h3-6H,2,7-10H2,1H3 |
| InChIKey | BEHMPEHTKMOYNY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|