C16H20N2O3 — CID 79936892
1-(2-oxo-3-phenylpropyl)-4-propylpiperazine-2,5-dione (PubChem CID 79936892) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(2-oxo-3-phenylpropyl)-4-propylpiperazine-2,5-dione.
| Compound Name | 1-(2-oxo-3-phenylpropyl)-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79936892 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-(2-oxo-3-phenylpropyl)-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CC(=O)Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C16H20N2O3/c1-2-8-17-11-16(21)18(12-15(17)20)10-14(19)9-13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3 |
| InChIKey | DIMQNAZOKHEIOF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |