C19H23N3O6 — CID 9193739
ethyl (3S)-1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidine-3-carboxylate (PubChem CID 9193739) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl (3S)-1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 9193739 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl (3S)-1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(CN2C(=O)C(=O)N(c3ccc(OC)cc3)C2=O)C1 |
| InChI | InChI=1S/C19H23N3O6/c1-3-28-18(25)13-5-4-10-20(11-13)12-21-16(23)17(24)22(19(21)26)14-6-8-15(27-2)9-7-14/h6-9,13H,3-5,10-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZYCBFHONMSXDAK-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|