C31H37NO6 — CID 10553968
ethyl 1-[2-[(4-hydroxyphenyl)-bis(4-methoxyphenyl)methoxy]ethyl]piperidine-3-carboxylate (PubChem CID 10553968) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is ethyl 1-[2-[(4-hydroxyphenyl)-bis(4-methoxyphenyl)methoxy]ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[(4-hydroxyphenyl)-bis(4-methoxyphenyl)methoxy]ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10553968 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | ethyl 1-[2-[(4-hydroxyphenyl)-bis(4-methoxyphenyl)methoxy]ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CCOC(c2ccc(O)cc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C31H37NO6/c1-4-37-30(34)23-6-5-19-32(22-23)20-21-38-31(24-7-13-27(33)14-8-24,25-9-15-28(35-2)16-10-25)26-11-17-29(36-3)18-12-26/h7-18,23,33H,4-6,19-22H2,1-3H3 |
| InChIKey | CGMYOJBZWKYFGV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|