C23H26N3O5+ — CID 9324892
1-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 9324892) has the molecular formula C23H26N3O5+ and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9324892 |
| Molecular Formula | C23H26N3O5+ |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccc([C@@H]2CCC[NH+]2CN2C(=O)C(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-3-31-19-10-6-16(7-11-19)20-5-4-14-24(20)15-25-21(27)22(28)26(23(25)29)17-8-12-18(30-2)13-9-17/h6-13,20H,3-5,14-15H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | XVLFPFGRRGXUJD-FQEVSTJZSA-O |
| XLogP | 1.77 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|