C17H18N3O2S2+ — CID 9322815
3-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione (PubChem CID 9322815) has the molecular formula C17H18N3O2S2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9322815 |
| Molecular Formula | C17H18N3O2S2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-[[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccco2)nn1C[NH+]1CCc2sccc2[C@H]1C1CC1 |
| InChI | InChI=1S/C17H17N3O2S2/c23-17-20(18-16(22-17)13-2-1-8-21-13)10-19-7-5-14-12(6-9-24-14)15(19)11-3-4-11/h1-2,6,8-9,11,15H,3-5,7,10H2/p+1/t15-/m1/s1 |
| InChIKey | IEIXTRRKESSZOP-OAHLLOKOSA-O |
| XLogP | 3.08 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|