C21H25N4S2+ — CID 9323000
5-benzyl-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 9323000) has the molecular formula C21H25N4S2+ and a molecular weight of 397.59 g/mol. Its IUPAC name is 5-benzyl-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-benzyl-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9323000 |
| Molecular Formula | C21H25N4S2+ |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 5-benzyl-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(Cc2ccccc2)nn(C[NH+]2CCc3sccc3[C@@H]2C2CC2)c1=S |
| InChI | InChI=1S/C21H24N4S2/c1-23-19(13-15-5-3-2-4-6-15)22-25(21(23)26)14-24-11-9-18-17(10-12-27-18)20(24)16-7-8-16/h2-6,10,12,16,20H,7-9,11,13-14H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | XHHOXWRSZQGLNB-FQEVSTJZSA-O |
| XLogP | 3.15 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|