C23H27N2OS+ — CID 9002745
2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone (PubChem CID 9002745) has the molecular formula C23H27N2OS+ and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone.
| Compound Name | 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 9002745 |
| Molecular Formula | C23H27N2OS+ |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@@H]1C1CC1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N2OS/c26-22(24-12-8-18(9-13-24)17-4-2-1-3-5-17)16-25-14-10-21-20(11-15-27-21)23(25)19-6-7-19/h1-5,8,11,15,19,23H,6-7,9-10,12-14,16H2/p+1/t23-/m0/s1 |
| InChIKey | AZNQGXMLORZXJG-QHCPKHFHSA-O |
| XLogP | 2.96 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |