C15H21N4S2+ — CID 9321252
5-cyclopropyl-4-methyl-2-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 9321252) has the molecular formula C15H21N4S2+ and a molecular weight of 321.50 g/mol. Its IUPAC name is 5-cyclopropyl-4-methyl-2-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-cyclopropyl-4-methyl-2-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9321252 |
| Molecular Formula | C15H21N4S2+ |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-cyclopropyl-4-methyl-2-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1c2ccsc2CC[NH+]1Cn1nc(C2CC2)n(C)c1=S |
| InChI | InChI=1S/C15H20N4S2/c1-10-12-6-8-21-13(12)5-7-18(10)9-19-15(20)17(2)14(16-19)11-3-4-11/h6,8,10-11H,3-5,7,9H2,1-2H3/p+1/t10-/m1/s1 |
| InChIKey | FZPWIIDZWGRYQB-SNVBAGLBSA-O |
| XLogP | 2.05 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|