C13H18N3O2S+ — CID 7301237
5-(furan-2-yl)-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 7301237) has the molecular formula C13H18N3O2S+ and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(furan-2-yl)-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 7301237 |
| Molecular Formula | C13H18N3O2S+ |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-(furan-2-yl)-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CC1CC[NH+](Cn2nc(-c3ccco3)oc2=S)CC1 |
| InChI | InChI=1S/C13H17N3O2S/c1-10-4-6-15(7-5-10)9-16-13(19)18-12(14-16)11-3-2-8-17-11/h2-3,8,10H,4-7,9H2,1H3/p+1 |
| InChIKey | GJZOQVOTEFABAI-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|