C13H14N5O2S+ — CID 2486812
bis(2-cyanoethyl)-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium (PubChem CID 2486812) has the molecular formula C13H14N5O2S+ and a molecular weight of 304.35 g/mol. Its IUPAC name is bis(2-cyanoethyl)-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium.
| Compound Name | bis(2-cyanoethyl)-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
|---|---|
| PubChem CID | 2486812 |
| Molecular Formula | C13H14N5O2S+ |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | bis(2-cyanoethyl)-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
| SMILES | N#CCC[NH+](CCC#N)Cn1nc(-c2ccco2)oc1=S |
| InChI | InChI=1S/C13H13N5O2S/c14-5-2-7-17(8-3-6-15)10-18-13(21)20-12(16-18)11-4-1-9-19-11/h1,4,9H,2-3,7-8,10H2/p+1 |
| InChIKey | KRYIVEJVSNBIOQ-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|