C20H23N3O4S — CID 9319426
3-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione (PubChem CID 9319426) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9319426 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
| SMILES | CCOc1cc2c(cc1OCC)CN(Cn1nc(-c3ccco3)oc1=S)CC2 |
| InChI | InChI=1S/C20H23N3O4S/c1-3-24-17-10-14-7-8-22(12-15(14)11-18(17)25-4-2)13-23-20(28)27-19(21-23)16-6-5-9-26-16/h5-6,9-11H,3-4,7-8,12-13H2,1-2H3 |
| InChIKey | YGVYENOJZPLDMX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|