C18H26N4O2S — CID 9319535
2-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 9319535) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9319535 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CCOc1cc2c(cc1OCC)CN(Cn1ncn(CC)c1=S)CC2 |
| InChI | InChI=1S/C18H26N4O2S/c1-4-21-12-19-22(18(21)25)13-20-8-7-14-9-16(23-5-2)17(24-6-3)10-15(14)11-20/h9-10,12H,4-8,11,13H2,1-3H3 |
| InChIKey | WXTVFJMPQQDGEY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|