C22H26N4O2S — CID 17463202
2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 17463202) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17463202 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CCn1cnn(CN2CCc3cc(OC)c(OC)cc3C2c2ccccc2)c1=S |
| InChI | InChI=1S/C22H26N4O2S/c1-4-24-14-23-26(22(24)29)15-25-11-10-17-12-19(27-2)20(28-3)13-18(17)21(25)16-8-6-5-7-9-16/h5-9,12-14,21H,4,10-11,15H2,1-3H3 |
| InChIKey | VIJGICILJUBVGW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|