C15H20N3O2S+ — CID 7832516
5-(4-ethoxyphenyl)-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 7832516) has the molecular formula C15H20N3O2S+ and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-ethoxyphenyl)-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 7832516 |
| Molecular Formula | C15H20N3O2S+ |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 5-(4-ethoxyphenyl)-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | CCOc1ccc(-c2nn(C[NH+]3CCCC3)c(=S)o2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-19-13-7-5-12(6-8-13)14-16-18(15(21)20-14)11-17-9-3-4-10-17/h5-8H,2-4,9-11H2,1H3/p+1 |
| InChIKey | LEKDRAJNQWUFIA-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 44.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|