C20H20N4O2S2 — CID 9282579
3-[[1,3-benzothiazol-2-ylmethyl(methyl)amino]methyl]-5-(4-ethoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 9282579) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[[1,3-benzothiazol-2-ylmethyl(methyl)amino]methyl]-5-(4-ethoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[1,3-benzothiazol-2-ylmethyl(methyl)amino]methyl]-5-(4-ethoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9282579 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[[1,3-benzothiazol-2-ylmethyl(methyl)amino]methyl]-5-(4-ethoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | CCOc1ccc(-c2nn(CN(C)Cc3nc4ccccc4s3)c(=S)o2)cc1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-3-25-15-10-8-14(9-11-15)19-22-24(20(27)26-19)13-23(2)12-18-21-16-6-4-5-7-17(16)28-18/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | HQEHSDJQHQAZIO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|