C22H20N4OS — CID 18149947
3-[[benzhydryl(methyl)amino]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione (PubChem CID 18149947) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 3-[[benzhydryl(methyl)amino]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[benzhydryl(methyl)amino]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 18149947 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[[benzhydryl(methyl)amino]methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
| SMILES | CN(Cn1nc(-c2ccncc2)oc1=S)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N4OS/c1-25(16-26-22(28)27-21(24-26)19-12-14-23-15-13-19)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,20H,16H2,1H3 |
| InChIKey | JMZPXCVQPLXXSC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|