C15H14FN3OS2 — CID 9318923
5-(4-fluorophenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9318923) has the molecular formula C15H14FN3OS2 and a molecular weight of 335.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-fluorophenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9318923 |
| Molecular Formula | C15H14FN3OS2 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CN(Cc1ccsc1)Cn1nc(-c2ccc(F)cc2)oc1=S |
| InChI | InChI=1S/C15H14FN3OS2/c1-18(8-11-6-7-22-9-11)10-19-15(21)20-14(17-19)12-2-4-13(16)5-3-12/h2-7,9H,8,10H2,1H3 |
| InChIKey | DACUQHCZDSMPES-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|