C21H23N3O3S — CID 9281625
3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 9281625) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9281625 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(CN(Cn2nc(-c3ccc(OC)cc3)oc2=S)C2CC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-25-18-9-3-15(4-10-18)13-23(17-7-8-17)14-24-21(28)27-20(22-24)16-5-11-19(26-2)12-6-16/h3-6,9-12,17H,7-8,13-14H2,1-2H3 |
| InChIKey | PEPHCYBHDANPSR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|