C19H23N5O2S+2 — CID 9280344
5-(4-methoxyphenyl)-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9280344) has the molecular formula C19H23N5O2S+2 and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-methoxyphenyl)-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9280344 |
| Molecular Formula | C19H23N5O2S+2 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(C[NH+]3CCN(c4cc[nH+]cc4)CC3)c(=S)o2)cc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-25-17-4-2-15(3-5-17)18-21-24(19(27)26-18)14-22-10-12-23(13-11-22)16-6-8-20-9-7-16/h2-9H,10-14H2,1H3/p+2 |
| InChIKey | KXHZYCKULQJVIB-UHFFFAOYSA-P |
| XLogP | 1.06 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|