C14H19N3O2+2 — CID 2166080
1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indole-2,3-dione (PubChem CID 2166080) has the molecular formula C14H19N3O2+2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indole-2,3-dione.
| Compound Name | 1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 2166080 |
| Molecular Formula | C14H19N3O2+2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indole-2,3-dione |
| SMILES | C[NH+]1CC[NH+](CN2C(=O)C(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C14H17N3O2/c1-15-6-8-16(9-7-15)10-17-12-5-3-2-4-11(12)13(18)14(17)19/h2-5H,6-10H2,1H3/p+2 |
| InChIKey | IKMDHAUGGJHNHD-UHFFFAOYSA-P |
| XLogP | -2.41 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|