C21H24N3O4S+ — CID 7911270
1-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]indole-2,3-dione (PubChem CID 7911270) has the molecular formula C21H24N3O4S+ and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 7911270 |
| Molecular Formula | C21H24N3O4S+ |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]indole-2,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](CN3C(=O)C(=O)c4ccccc43)CC2)cc1C |
| InChI | InChI=1S/C21H23N3O4S/c1-15-7-8-17(13-16(15)2)29(27,28)23-11-9-22(10-12-23)14-24-19-6-4-3-5-18(19)20(25)21(24)26/h3-8,13H,9-12,14H2,1-2H3/p+1 |
| InChIKey | OKJGFIJYNZPSNJ-UHFFFAOYSA-O |
| XLogP | 0.38 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|