C21H20N3O2S+ — CID 9330255
1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]indole-2,3-dione (PubChem CID 9330255) has the molecular formula C21H20N3O2S+ and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9330255 |
| Molecular Formula | C21H20N3O2S+ |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CCCC[C@@H]2c2nc3ccccc3s2)c2ccccc21 |
| InChI | InChI=1S/C21H19N3O2S/c25-19-14-7-1-3-9-16(14)24(21(19)26)13-23-12-6-5-10-17(23)20-22-15-8-2-4-11-18(15)27-20/h1-4,7-9,11,17H,5-6,10,12-13H2/p+1/t17-/m1/s1 |
| InChIKey | OZHNZUIWLWBDEG-QGZVFWFLSA-O |
| XLogP | 2.59 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|