C15H20N2O3S2 — CID 9135721
3-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 9135721) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 9135721 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[NH+]1CCCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H20N2O3S2/c18-22(19,20)11-5-10-17-9-4-3-7-13(17)15-16-12-6-1-2-8-14(12)21-15/h1-2,6,8,13H,3-5,7,9-11H2,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | DJJSCRTXZUHSHH-CYBMUJFWSA-N |
| XLogP | 1.34 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|