C15H25N4O3+ — CID 2575572
3-[(4-acetylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2575572) has the molecular formula C15H25N4O3+ and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[(4-acetylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-acetylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2575572 |
| Molecular Formula | C15H25N4O3+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[(4-acetylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(=O)N1CC[NH+](CN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C15H24N4O3/c1-12(20)18-9-7-17(8-10-18)11-19-13(21)15(16-14(19)22)5-3-2-4-6-15/h2-11H2,1H3,(H,16,22)/p+1 |
| InChIKey | WMJKHDIQOOJPIF-UHFFFAOYSA-O |
| XLogP | -1.05 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|