C13H24N4O2+2 — CID 9242366
8-methyl-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione (PubChem CID 9242366) has the molecular formula C13H24N4O2+2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 8-methyl-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9242366 |
| Molecular Formula | C13H24N4O2+2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 8-methyl-3-(pyrrolidin-1-ium-1-ylmethyl)-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dione |
| SMILES | C[NH+]1CCC2(CC1)NC(=O)N(C[NH+]1CCCC1)C2=O |
| InChI | InChI=1S/C13H22N4O2/c1-15-8-4-13(5-9-15)11(18)17(12(19)14-13)10-16-6-2-3-7-16/h2-10H2,1H3,(H,14,19)/p+2 |
| InChIKey | UZRYRISAZFYDGZ-UHFFFAOYSA-P |
| XLogP | -2.78 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|