C12H22N3O3+ — CID 1422079
3-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 1422079) has the molecular formula C12H22N3O3+ and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1422079 |
| Molecular Formula | C12H22N3O3+ |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C[C@@H](O)C[NH+]2CCCC2)C1=O |
| InChI | InChI=1S/C12H21N3O3/c1-12(2)10(17)15(11(18)13-12)8-9(16)7-14-5-3-4-6-14/h9,16H,3-8H2,1-2H3,(H,13,18)/p+1/t9-/m0/s1 |
| InChIKey | WIVARDLUAQIXCF-VIFPVBQESA-O |
| XLogP | -1.64 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|