C19H29N5O3+2 — CID 9459459
3-[(2S)-2-hydroxy-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 9459459) has the molecular formula C19H29N5O3+2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 9459459 |
| Molecular Formula | C19H29N5O3+2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1C[C@H](O)C[NH+]1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C19H27N5O3/c25-15(14-24-17(26)19(21-18(24)27)6-2-3-7-19)13-22-9-11-23(12-10-22)16-5-1-4-8-20-16/h1,4-5,8,15,25H,2-3,6-7,9-14H2,(H,21,27)/p+2/t15-/m1/s1 |
| InChIKey | QUJKSVKDWJXJRK-OAHLLOKOSA-P |
| XLogP | -1.57 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|