C13H24N3O3+ — CID 6949688
3-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 6949688) has the molecular formula C13H24N3O3+ and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 6949688 |
| Molecular Formula | C13H24N3O3+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C[C@@H](O)C[NH+]2CCCCC2)C1=O |
| InChI | InChI=1S/C13H23N3O3/c1-13(2)11(18)16(12(19)14-13)9-10(17)8-15-6-4-3-5-7-15/h10,17H,3-9H2,1-2H3,(H,14,19)/p+1/t10-/m0/s1 |
| InChIKey | PQZUVURJXRIBLD-JTQLQIEISA-O |
| XLogP | -1.25 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|