C15H16Cl2N2O3 — CID 47053145
3-[2-(2,5-dichlorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 47053145) has the molecular formula C15H16Cl2N2O3 and a molecular weight of 343.21 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-(2,5-dichlorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 47053145 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-[2-(2,5-dichlorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CC(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O3/c16-9-3-4-11(17)10(7-9)12(20)8-19-13(21)15(18-14(19)22)5-1-2-6-15/h3-4,7,12,20H,1-2,5-6,8H2,(H,18,22) |
| InChIKey | VUIMWVIWTHXVMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|