C20H23ClN3O3S+ — CID 9172092
(5-chlorothiophen-2-yl)methyl-[[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-prop-2-enylazanium (PubChem CID 9172092) has the molecular formula C20H23ClN3O3S+ and a molecular weight of 420.94 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9172092 |
| Molecular Formula | C20H23ClN3O3S+ |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](Cc1ccc(Cl)s1)CN1C(=O)N[C@@](C)(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C20H22ClN3O3S/c1-4-10-23(12-16-8-9-17(21)28-16)13-24-18(25)20(2,22-19(24)26)14-6-5-7-15(11-14)27-3/h4-9,11H,1,10,12-13H2,2-3H3,(H,22,26)/p+1/t20-/m0/s1 |
| InChIKey | QCVHYYVEWPDTPR-FQEVSTJZSA-O |
| XLogP | 2.41 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|