C16H14BrClF2N2OS — CID 78828504
N-(2-bromo-4,6-difluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetamide (PubChem CID 78828504) has the molecular formula C16H14BrClF2N2OS and a molecular weight of 435.72 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetamide.
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 78828504 |
| Molecular Formula | C16H14BrClF2N2OS |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1c(F)cc(F)cc1Br)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H14BrClF2N2OS/c1-2-5-22(8-11-3-4-14(18)24-11)9-15(23)21-16-12(17)6-10(19)7-13(16)20/h2-4,6-7H,1,5,8-9H2,(H,21,23) |
| InChIKey | IPSOWVBMKCDZQZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|