C16H16BrFN2OS — CID 9299962
2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 9299962) has the molecular formula C16H16BrFN2OS and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9299962 |
| Molecular Formula | C16H16BrFN2OS |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(F)cc1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H16BrFN2OS/c1-2-9-20(10-14-7-8-15(17)22-14)11-16(21)19-13-5-3-12(18)4-6-13/h2-8H,1,9-11H2,(H,19,21) |
| InChIKey | VZYROJGAANUFLT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|