C15H15FN2O3S2 — CID 26055171
N-(4-fluorophenyl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 26055171) has the molecular formula C15H15FN2O3S2 and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 26055171 |
| Molecular Formula | C15H15FN2O3S2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H15FN2O3S2/c1-2-9-18(23(20,21)15-4-3-10-22-15)11-14(19)17-13-7-5-12(16)6-8-13/h2-8,10H,1,9,11H2,(H,17,19) |
| InChIKey | QAQWIKLUOICQDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|