C16H16N2O5S2 — CID 26055162
N-(1,3-benzodioxol-5-yl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 26055162) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 26055162 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1ccc2c(c1)OCO2)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-2-7-18(25(20,21)16-4-3-8-24-16)10-15(19)17-12-5-6-13-14(9-12)23-11-22-13/h2-6,8-9H,1,7,10-11H2,(H,17,19) |
| InChIKey | FVKFGRFLRHDDRK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|