C16H18N4O4S2 — CID 55489697
2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide (PubChem CID 55489697) has the molecular formula C16H18N4O4S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55489697 |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCNC2=O)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H18N4O4S2/c1-19(26(23,24)15-3-2-10-25-15)11-14(21)18-12-4-6-13(7-5-12)20-9-8-17-16(20)22/h2-7,10H,8-9,11H2,1H3,(H,17,22)(H,18,21) |
| InChIKey | PVFPRDPYCBSUAI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |