C15H15NO4S2 — CID 100548313
methyl 2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]benzoate (PubChem CID 100548313) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]benzoate.
| Compound Name | methyl 2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]benzoate |
|---|---|
| PubChem CID | 100548313 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl 2-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]benzoate |
| SMILES | C=CCN(c1ccccc1C(=O)OC)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H15NO4S2/c1-3-10-16(22(18,19)14-9-6-11-21-14)13-8-5-4-7-12(13)15(17)20-2/h3-9,11H,1,10H2,2H3 |
| InChIKey | SLGHAYKTMYEDFH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|