C14H15NO3S2 — CID 100548025
N-(4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 100548025) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100548025 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCN(c1ccc(OC)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H15NO3S2/c1-3-10-15(12-6-8-13(18-2)9-7-12)20(16,17)14-5-4-11-19-14/h3-9,11H,1,10H2,2H3 |
| InChIKey | UPJOZWPVQBLQJM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|