C14H12F3NO2S2 — CID 100551054
N-prop-2-enyl-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 100551054) has the molecular formula C14H12F3NO2S2 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-prop-2-enyl-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-prop-2-enyl-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100551054 |
| Molecular Formula | C14H12F3NO2S2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-prop-2-enyl-N-[4-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | C=CCN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H12F3NO2S2/c1-2-9-18(22(19,20)13-4-3-10-21-13)12-7-5-11(6-8-12)14(15,16)17/h2-8,10H,1,9H2 |
| InChIKey | LDMCEOWGLVOYAS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|