C16H19NO2S2 — CID 100547585
N-(4-propan-2-ylphenyl)-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 100547585) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | N-(4-propan-2-ylphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100547585 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCN(c1ccc(C(C)C)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H19NO2S2/c1-4-11-17(21(18,19)16-6-5-12-20-16)15-9-7-14(8-10-15)13(2)3/h4-10,12-13H,1,11H2,2-3H3 |
| InChIKey | OVQZUCJWGVQPIC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|